2,6-Difluorophenylhydrazine hydrochloride

2,6-Difluorophenylhydrazine hydrochloride - Names and Identifiers

Name	(2,6-difluorophenyl)diazanium chloride
Synonyms	2,6-Difluorophenylhydrazine Hcl 2,6-difluorophenyl)diazaniuM chloride (2,6-difluorophenyl)diazanium chloride 6-Difluorophenylhdrazine hydrochloride 2,6-Difluorophenylhydrazine hydrochloride (2,6-Difluorophenyl)hydrazine hydrochloride 1,3-Difluoro-2-hydrazinobenzene hydrochloride
CAS	502496-26-6
InChI	InChI=1/C6H6F2N2.ClH/c7-4-2-1-3-5(8)6(4)10-9;/h1-3,10H,9H2;1H

2,6-Difluorophenylhydrazine hydrochloride - Physico-chemical Properties

Molecular Formula	C6H7ClF2N2
Molar Mass	180.59
Boling Point	168.1°C at 760 mmHg
Flash Point	55.5°C
Vapor Presure	1.64mmHg at 25°C
Appearance	Crystallization
Storage Condition	Sealed in dry,Room Temperature
MDL	MFCD03094169

2,6-Difluorophenylhydrazine hydrochloride - Introduction

(2,6-difluorophenyl)diazanium chloride is an organic compound whose chemical formula is C6H5F2N2Cl. The following is a description of some of the properties, uses, preparation and safety information of the compound:

Nature:
-Appearance: Colorless crystalline solid.
-Melting point: about 85-87 ℃.
-Solubility: Soluble in water and common organic solvents.

Use:
- (2,6-difluorophenyl)diazanium chloride are commonly used as reagents in organic synthesis and can be used to synthesize other organic compounds.
-It can also be used as a precursor for organic catalysts.

Preparation Method:
(2,6-difluorophenyl) The preparation of diazanium chloride is generally carried out by the following steps:
1. First, 2,6-difluorophenyl hydrazine is reacted with hydrochloric acid to generate (2,6-difluorophenyl)diazanium chloride under appropriate conditions.

Safety Information:
- (2,6-difluorophenyl)diazanium chloride are generally relatively safe under normal operating conditions, the following safety measures still need to be considered:
-Contact with skin or eyes may cause irritation, so wear appropriate protective equipment, such as gloves and goggles, during operation.
-in the operation, should maintain good ventilation, avoid inhalation of gas or dust.
-Correct laboratory practices and appropriate safety procedures should be observed when handling the compound.

Last Update：2024-04-10 22:29:15